C25H35NO3 — CID 21038686
5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-3-phenylbut-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide (PubChem CID 21038686) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-3-phenylbut-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide.
| Compound Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-3-phenylbut-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide |
|---|---|
| PubChem CID | 21038686 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-3-phenylbut-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide |
| SMILES | CN(C)C(=O)CCCCC1=C[C@H]2C[C@@H](O)[C@H](/C=C/[C@](C)(O)c3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C25H35NO3/c1-25(29,20-10-5-4-6-11-20)14-13-21-22-16-18(15-19(22)17-23(21)27)9-7-8-12-24(28)26(2)3/h4-6,10-11,13-15,19,21-23,27,29H,7-9,12,16-17H2,1-3H3/b14-13+/t19-,21+,22-,23+,25-/m0/s1 |
| InChIKey | IOZHXPVFRARZEJ-PAYIURGASA-N |
| XLogP | 4.04 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|