C24H35NO — CID 21038980
(2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(E)-2-(2-methylphenyl)ethenyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21038980) has the molecular formula C24H35NO and a molecular weight of 353.55 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(E)-2-(2-methylphenyl)ethenyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(E)-2-(2-methylphenyl)ethenyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21038980 |
| Molecular Formula | C24H35NO |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(E)-2-(2-methylphenyl)ethenyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | Cc1ccccc1/C=C/[C@@H]1[C@H]2CC(CCCCCN(C)C)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C24H35NO/c1-18-9-6-7-11-20(18)12-13-22-23-16-19(15-21(23)17-24(22)26)10-5-4-8-14-25(2)3/h6-7,9,11-13,15,21-24,26H,4-5,8,10,14,16-17H2,1-3H3/b13-12+/t21-,22+,23-,24+/m0/s1 |
| InChIKey | QBBVTBDOTCXSLS-HAPNSICMSA-N |
| XLogP | 5.07 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|