C27H42N2O2 — CID 21039075
(2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(E,3R)-4-[4-(dimethylamino)phenyl]-3-hydroxybut-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21039075) has the molecular formula C27H42N2O2 and a molecular weight of 426.65 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(E,3R)-4-[4-(dimethylamino)phenyl]-3-hydroxybut-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(E,3R)-4-[4-(dimethylamino)phenyl]-3-hydroxybut-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21039075 |
| Molecular Formula | C27H42N2O2 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(E,3R)-4-[4-(dimethylamino)phenyl]-3-hydroxybut-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CN(C)CCCCCC1=C[C@H]2C[C@@H](O)[C@H](/C=C/[C@H](O)Cc3ccc(N(C)C)cc3)[C@H]2C1 |
| InChI | InChI=1S/C27H42N2O2/c1-28(2)15-7-5-6-8-21-16-22-19-27(31)25(26(22)18-21)14-13-24(30)17-20-9-11-23(12-10-20)29(3)4/h9-14,16,22,24-27,30-31H,5-8,15,17-19H2,1-4H3/b14-13+/t22-,24-,25+,26-,27+/m0/s1 |
| InChIKey | WGLWPTNBQOKEMQ-HYASBVSOSA-N |
| XLogP | 4.28 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|