C24H38N2O2 — CID 21039164
(2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(R)-[4-(dimethylamino)phenyl]-hydroxymethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21039164) has the molecular formula C24H38N2O2 and a molecular weight of 386.58 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(R)-[4-(dimethylamino)phenyl]-hydroxymethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(R)-[4-(dimethylamino)phenyl]-hydroxymethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21039164 |
| Molecular Formula | C24H38N2O2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(R)-[4-(dimethylamino)phenyl]-hydroxymethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CN(C)CCCCCC1=C[C@H]2C[C@@H](O)[C@H]([C@@H](O)c3ccc(N(C)C)cc3)[C@H]2C1 |
| InChI | InChI=1S/C24H38N2O2/c1-25(2)13-7-5-6-8-17-14-19-16-22(27)23(21(19)15-17)24(28)18-9-11-20(12-10-18)26(3)4/h9-12,14,19,21-24,27-28H,5-8,13,15-16H2,1-4H3/t19-,21-,22+,23+,24-/m0/s1 |
| InChIKey | JANSKBVWACKZEO-IPKGGZNWSA-N |
| XLogP | 3.85 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|