C29H45NO2 — CID 21039188
(2R,3R,3aS,6aS)-5-(5-anilinopentyl)-3-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21039188) has the molecular formula C29H45NO2 and a molecular weight of 439.68 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-(5-anilinopentyl)-3-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-(5-anilinopentyl)-3-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21039188 |
| Molecular Formula | C29H45NO2 |
| Molecular Weight | 439.68 g/mol |
| Exact Mass | 439.35 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-(5-anilinopentyl)-3-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCC[C@H](C)C[C@H](O)/C=C/[C@@H]1[C@H]2CC(CCCCCNc3ccccc3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C29H45NO2/c1-3-4-11-22(2)18-26(31)15-16-27-28-20-23(19-24(28)21-29(27)32)12-7-6-10-17-30-25-13-8-5-9-14-25/h5,8-9,13-16,19,22,24,26-32H,3-4,6-7,10-12,17-18,20-21H2,1-2H3/b16-15+/t22-,24-,26+,27+,28-,29+/m0/s1 |
| InChIKey | BADWIVDPGHZISP-UUDGPULTSA-N |
| XLogP | 6.74 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.68 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|