C28H43NO2 — CID 21039189
(2R,3R,3aS,6aS)-5-(5-anilinopentyl)-3-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21039189) has the molecular formula C28H43NO2 and a molecular weight of 425.66 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-(5-anilinopentyl)-3-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-(5-anilinopentyl)-3-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21039189 |
| Molecular Formula | C28H43NO2 |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 425.33 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-(5-anilinopentyl)-3-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCC[C@](C)(O)C/C=C/[C@@H]1[C@H]2CC(CCCCCNc3ccccc3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C28H43NO2/c1-3-4-16-28(2,31)17-11-15-25-26-20-22(19-23(26)21-27(25)30)12-7-6-10-18-29-24-13-8-5-9-14-24/h5,8-9,11,13-15,19,23,25-27,29-31H,3-4,6-7,10,12,16-18,20-21H2,1-2H3/b15-11+/t23-,25+,26-,27+,28-/m0/s1 |
| InChIKey | NBWXXFHDQWJOLC-TXDVMFAZSA-N |
| XLogP | 6.49 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|