C24H44N2O2 — CID 21039356
(2R,3R,3aS,6aS)-5-[[4-(dimethylamino)butylamino]methyl]-3-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21039356) has the molecular formula C24H44N2O2 and a molecular weight of 392.63 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[[4-(dimethylamino)butylamino]methyl]-3-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[[4-(dimethylamino)butylamino]methyl]-3-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21039356 |
| Molecular Formula | C24H44N2O2 |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.34 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[[4-(dimethylamino)butylamino]methyl]-3-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCC[C@](C)(O)C/C=C/[C@@H]1[C@H]2CC(CNCCCCN(C)C)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C24H44N2O2/c1-5-6-11-24(2,28)12-9-10-21-22-16-19(15-20(22)17-23(21)27)18-25-13-7-8-14-26(3)4/h9-10,15,20-23,25,27-28H,5-8,11-14,16-18H2,1-4H3/b10-9+/t20-,21+,22-,23+,24-/m0/s1 |
| InChIKey | LVYHPGBGYNCWGS-UBYSJBBKSA-N |
| XLogP | 3.75 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|