C46H68Cl2N8O2 — CID 21039519
N-[4-[5-[[2-acetamido-4-(dioctylamino)phenyl]diazenyl]-3-tert-butyl-4-cyanopyrazol-1-yl]-3,5-dichlorophenyl]octanamide (PubChem CID 21039519) has the molecular formula C46H68Cl2N8O2 and a molecular weight of 836.01 g/mol. Its IUPAC name is N-[4-[5-[[2-acetamido-4-(dioctylamino)phenyl]diazenyl]-3-tert-butyl-4-cyanopyrazol-1-yl]-3,5-dichlorophenyl]octanamide.
| Compound Name | N-[4-[5-[[2-acetamido-4-(dioctylamino)phenyl]diazenyl]-3-tert-butyl-4-cyanopyrazol-1-yl]-3,5-dichlorophenyl]octanamide |
|---|---|
| PubChem CID | 21039519 |
| Molecular Formula | C46H68Cl2N8O2 |
| Molecular Weight | 836.01 g/mol |
| Exact Mass | 834.48 |
| IUPAC Name | N-[4-[5-[[2-acetamido-4-(dioctylamino)phenyl]diazenyl]-3-tert-butyl-4-cyanopyrazol-1-yl]-3,5-dichlorophenyl]octanamide |
| SMILES | CCCCCCCCN(CCCCCCCC)c1ccc(/N=N/c2c(C#N)c(C(C)(C)C)nn2-c2c(Cl)cc(NC(=O)CCCCCCC)cc2Cl)c(NC(C)=O)c1 |
| InChI | InChI=1S/C46H68Cl2N8O2/c1-8-11-14-17-20-23-28-55(29-24-21-18-15-12-9-2)36-26-27-40(41(32-36)50-34(4)57)52-53-45-37(33-49)44(46(5,6)7)54-56(45)43-38(47)30-35(31-39(43)48)51-42(58)25-22-19-16-13-10-3/h26-27,30-32H,8-25,28-29H2,1-7H3,(H,50,57)(H,51,58)/b53-52+ |
| InChIKey | USHPDTWOXLPBLJ-KNPAHQFXSA-N |
| XLogP | 14.55 |
| TPSA | 127.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.01 |
| LogP ≤ 5 | 14.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|