C10H10N2OS — CID 2103958
5-(3,4-dimethylphenyl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 2103958) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(3,4-dimethylphenyl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 2103958 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | Cc1ccc(-c2n[nH]c(=S)o2)cc1C |
| InChI | InChI=1S/C10H10N2OS/c1-6-3-4-8(5-7(6)2)9-11-12-10(14)13-9/h3-5H,1-2H3,(H,12,14) |
| InChIKey | ZKMQIPCAKYEHCX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|