C15H18N4 — CID 21040348
3-N,3-N,4-trimethyl-6-phenyldiazenylbenzene-1,3-diamine (PubChem CID 21040348) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is 3-N,3-N,4-trimethyl-6-phenyldiazenylbenzene-1,3-diamine.
| Compound Name | 3-N,3-N,4-trimethyl-6-phenyldiazenylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 21040348 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 3-N,3-N,4-trimethyl-6-phenyldiazenylbenzene-1,3-diamine |
| SMILES | Cc1cc(/N=N/c2ccccc2)c(N)cc1N(C)C |
| InChI | InChI=1S/C15H18N4/c1-11-9-14(13(16)10-15(11)19(2)3)18-17-12-7-5-4-6-8-12/h4-10H,16H2,1-3H3/b18-17+ |
| InChIKey | CNQUTNQVSJSJMW-ISLYRVAYSA-N |
| XLogP | 4.06 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|