About 3,6-dimethylidenecyclohexa-1,4-diene-1,4-diamine
3,6-dimethylidenecyclohexa-1,4-diene-1,4-diamine (PubChem CID 21040582) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 3,6-dimethylidenecyclohexa-1,4-diene-1,4-diamine.
Molecular Properties
| Compound Name | 3,6-dimethylidenecyclohexa-1,4-diene-1,4-diamine |
| PubChem CID | 21040582 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 3,6-dimethylidenecyclohexa-1,4-diene-1,4-diamine |
| SMILES | C=c1cc(N)c(=C)cc1N |
| InChI | InChI=1S/C8H10N2/c1-5-3-8(10)6(2)4-7(5)9/h3-4H,1-2,9-10H2 |
| InChIKey | RMACFRZSRYMBDX-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dimethylidenecyclohexa-1,4-diene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethylidenecyclohexa-1,4-diene-1,4-diamine?
The IUPAC name of 3,6-dimethylidenecyclohexa-1,4-diene-1,4-diamine (CID 21040582) is 3,6-dimethylidenecyclohexa-1,4-diene-1,4-diamine.
What is the SMILES notation for 3,6-dimethylidenecyclohexa-1,4-diene-1,4-diamine?
The canonical SMILES for 3,6-dimethylidenecyclohexa-1,4-diene-1,4-diamine is C=c1cc(N)c(=C)cc1N.
What is the InChIKey of 3,6-dimethylidenecyclohexa-1,4-diene-1,4-diamine?
The InChIKey is RMACFRZSRYMBDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-5-3-8(10)6(2)4-7(5)9/h3-4H,1-2,9-10H2.
What are the key properties of 3,6-dimethylidenecyclohexa-1,4-diene-1,4-diamine?
3,6-dimethylidenecyclohexa-1,4-diene-1,4-diamine has a molecular weight of 134.18 g/mol, XLogP of -0.33, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethylidenecyclohexa-1,4-diene-1,4-diamine is sourced from PubChem (CID 21040582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).