C11H16FN3O3 — CID 21040932
4-amino-1-[5-ethyl-3-fluoro-4-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 21040932) has the molecular formula C11H16FN3O3 and a molecular weight of 257.27 g/mol. Its IUPAC name is 4-amino-1-[5-ethyl-3-fluoro-4-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[5-ethyl-3-fluoro-4-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 21040932 |
| Molecular Formula | C11H16FN3O3 |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 4-amino-1-[5-ethyl-3-fluoro-4-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | CCC1OC(n2ccc(N)nc2=O)C(F)C1CO |
| InChI | InChI=1S/C11H16FN3O3/c1-2-7-6(5-16)9(12)10(18-7)15-4-3-8(13)14-11(15)17/h3-4,6-7,9-10,16H,2,5H2,1H3,(H2,13,14,17) |
| InChIKey | JZMKKTVBOQVTTO-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |