C33H39F6N5O3 — CID 21041073
[3,5-bis(trifluoromethyl)phenyl]-[(2R)-2-(1H-indol-3-ylmethyl)-4-[(3Z)-3-(3-morpholin-4-ylpropoxyimino)butyl]piperazin-1-yl]methanone (PubChem CID 21041073) has the molecular formula C33H39F6N5O3 and a molecular weight of 667.69 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-[(2R)-2-(1H-indol-3-ylmethyl)-4-[(3Z)-3-(3-morpholin-4-ylpropoxyimino)butyl]piperazin-1-yl]methanone.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-[(2R)-2-(1H-indol-3-ylmethyl)-4-[(3Z)-3-(3-morpholin-4-ylpropoxyimino)butyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 21041073 |
| Molecular Formula | C33H39F6N5O3 |
| Molecular Weight | 667.69 g/mol |
| Exact Mass | 667.30 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-[(2R)-2-(1H-indol-3-ylmethyl)-4-[(3Z)-3-(3-morpholin-4-ylpropoxyimino)butyl]piperazin-1-yl]methanone |
| SMILES | C/C(CCN1CCN(C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@H](Cc2c[nH]c3ccccc23)C1)=N/OCCCN1CCOCC1 |
| InChI | InChI=1S/C33H39F6N5O3/c1-23(41-47-14-4-8-42-12-15-46-16-13-42)7-9-43-10-11-44(28(22-43)19-25-21-40-30-6-3-2-5-29(25)30)31(45)24-17-26(32(34,35)36)20-27(18-24)33(37,38)39/h2-3,5-6,17-18,20-21,28,40H,4,7-16,19,22H2,1H3/b41-23-/t28-/m1/s1 |
| InChIKey | UUPAVGLFLYUYFK-PPMPQVTDSA-N |
| XLogP | 6.08 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.69 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|