C22H21BrN6O4S3 — CID 21041275
5-(4-bromophenyl)-6-[2-(5-methylsulfanylpyrimidin-2-yl)oxyethoxy]-N-(thiophen-2-ylmethylsulfamoyl)pyrimidin-4-amine (PubChem CID 21041275) has the molecular formula C22H21BrN6O4S3 and a molecular weight of 609.55 g/mol. Its IUPAC name is 5-(4-bromophenyl)-6-[2-(5-methylsulfanylpyrimidin-2-yl)oxyethoxy]-N-(thiophen-2-ylmethylsulfamoyl)pyrimidin-4-amine.
| Compound Name | 5-(4-bromophenyl)-6-[2-(5-methylsulfanylpyrimidin-2-yl)oxyethoxy]-N-(thiophen-2-ylmethylsulfamoyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 21041275 |
| Molecular Formula | C22H21BrN6O4S3 |
| Molecular Weight | 609.55 g/mol |
| Exact Mass | 608.00 |
| IUPAC Name | 5-(4-bromophenyl)-6-[2-(5-methylsulfanylpyrimidin-2-yl)oxyethoxy]-N-(thiophen-2-ylmethylsulfamoyl)pyrimidin-4-amine |
| SMILES | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)NCc3cccs3)c2-c2ccc(Br)cc2)nc1 |
| InChI | InChI=1S/C22H21BrN6O4S3/c1-34-18-11-24-22(25-12-18)33-9-8-32-21-19(15-4-6-16(23)7-5-15)20(26-14-27-21)29-36(30,31)28-13-17-3-2-10-35-17/h2-7,10-12,14,28H,8-9,13H2,1H3,(H,26,27,29) |
| InChIKey | UJFBPCWYGQVKAP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|