C13H3BrF8 — CID 21041896
1-bromo-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)benzene (PubChem CID 21041896) has the molecular formula C13H3BrF8 and a molecular weight of 391.06 g/mol. Its IUPAC name is 1-bromo-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)benzene.
| Compound Name | 1-bromo-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)benzene |
|---|---|
| PubChem CID | 21041896 |
| Molecular Formula | C13H3BrF8 |
| Molecular Weight | 391.06 g/mol |
| Exact Mass | 389.93 |
| IUPAC Name | 1-bromo-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)benzene |
| SMILES | Cc1c(F)c(F)c(-c2c(F)c(F)c(Br)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C13H3BrF8/c1-2-6(15)8(17)3(9(18)7(2)16)4-10(19)12(21)5(14)13(22)11(4)20/h1H3 |
| InChIKey | KXWYCTZSPCHLLF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.06 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|