About 4,5,6-tribromo-2-methylbenzene-1,3-diol
4,5,6-tribromo-2-methylbenzene-1,3-diol (PubChem CID 21041923) has the molecular formula C7H5Br3O2
and a molecular weight of 360.83 g/mol. Its IUPAC name is 4,5,6-tribromo-2-methylbenzene-1,3-diol.
Molecular Properties
| Compound Name | 4,5,6-tribromo-2-methylbenzene-1,3-diol |
| PubChem CID | 21041923 |
| Molecular Formula | C7H5Br3O2 |
| Molecular Weight | 360.83 g/mol |
| Exact Mass | 357.78 |
| IUPAC Name | 4,5,6-tribromo-2-methylbenzene-1,3-diol |
| SMILES | Cc1c(O)c(Br)c(Br)c(Br)c1O |
| InChI | InChI=1S/C7H5Br3O2/c1-2-6(11)4(9)3(8)5(10)7(2)12/h11-12H,1H3 |
| InChIKey | QQBLLBMTKYVYKN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.83 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 4,5,6-tribromo-2-methylbenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6-tribromo-2-methylbenzene-1,3-diol?
The IUPAC name of 4,5,6-tribromo-2-methylbenzene-1,3-diol (CID 21041923) is 4,5,6-tribromo-2-methylbenzene-1,3-diol.
What is the SMILES notation for 4,5,6-tribromo-2-methylbenzene-1,3-diol?
The canonical SMILES for 4,5,6-tribromo-2-methylbenzene-1,3-diol is Cc1c(O)c(Br)c(Br)c(Br)c1O.
What is the InChIKey of 4,5,6-tribromo-2-methylbenzene-1,3-diol?
The InChIKey is QQBLLBMTKYVYKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Br3O2/c1-2-6(11)4(9)3(8)5(10)7(2)12/h11-12H,1H3.
What are the key properties of 4,5,6-tribromo-2-methylbenzene-1,3-diol?
4,5,6-tribromo-2-methylbenzene-1,3-diol has a molecular weight of 360.83 g/mol, XLogP of 3.69, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6-tribromo-2-methylbenzene-1,3-diol is sourced from PubChem (CID 21041923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).