C16H13F15O3 — CID 21041932
[1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 21041932) has the molecular formula C16H13F15O3 and a molecular weight of 538.25 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 21041932 |
| Molecular Formula | C16H13F15O3 |
| Molecular Weight | 538.25 g/mol |
| Exact Mass | 538.06 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC(C1CCC(C(O)(C(F)(F)F)C(F)(F)F)CC1)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H13F15O3/c1-6(12(17,18)19)9(32)34-11(15(26,27)28,16(29,30)31)8-4-2-7(3-5-8)10(33,13(20,21)22)14(23,24)25/h7-8,33H,1-5H2 |
| InChIKey | LELCZQZTXBIBSX-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.25 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|