C13H9F15O3 — CID 21041941
[1,1,1,7,7,7-hexafluoro-6-hydroxy-2,6-bis(trifluoromethyl)heptan-2-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 21041941) has the molecular formula C13H9F15O3 and a molecular weight of 498.18 g/mol. Its IUPAC name is [1,1,1,7,7,7-hexafluoro-6-hydroxy-2,6-bis(trifluoromethyl)heptan-2-yl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [1,1,1,7,7,7-hexafluoro-6-hydroxy-2,6-bis(trifluoromethyl)heptan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 21041941 |
| Molecular Formula | C13H9F15O3 |
| Molecular Weight | 498.18 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | [1,1,1,7,7,7-hexafluoro-6-hydroxy-2,6-bis(trifluoromethyl)heptan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC(CCCC(O)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H9F15O3/c1-5(9(14,15)16)6(29)31-8(12(23,24)25,13(26,27)28)4-2-3-7(30,10(17,18)19)11(20,21)22/h30H,1-4H2 |
| InChIKey | PLAUGUYRVIEQEN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.18 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|