About (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methoxycarbonylamino)hexanoate
(2,5-dioxopyrrolidin-1-yl) 2,6-bis(methoxycarbonylamino)hexanoate (PubChem CID 21042081) has the molecular formula C14H21N3O8
and a molecular weight of 359.34 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methoxycarbonylamino)hexanoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methoxycarbonylamino)hexanoate |
| PubChem CID | 21042081 |
| Molecular Formula | C14H21N3O8 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methoxycarbonylamino)hexanoate |
| SMILES | COC(=O)NCCCCC(NC(=O)OC)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H21N3O8/c1-23-13(21)15-8-4-3-5-9(16-14(22)24-2)12(20)25-17-10(18)6-7-11(17)19/h9H,3-8H2,1-2H3,(H,15,21)(H,16,22) |
| InChIKey | GKEZLFIHBLWCTR-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methoxycarbonylamino)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methoxycarbonylamino)hexanoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methoxycarbonylamino)hexanoate (CID 21042081) is (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methoxycarbonylamino)hexanoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methoxycarbonylamino)hexanoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methoxycarbonylamino)hexanoate is COC(=O)NCCCCC(NC(=O)OC)C(=O)ON1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methoxycarbonylamino)hexanoate?
The InChIKey is GKEZLFIHBLWCTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O8/c1-23-13(21)15-8-4-3-5-9(16-14(22)24-2)12(20)25-17-10(18)6-7-11(17)19/h9H,3-8H2,1-2H3,(H,15,21)(H,16,22).
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methoxycarbonylamino)hexanoate?
(2,5-dioxopyrrolidin-1-yl) 2,6-bis(methoxycarbonylamino)hexanoate has a molecular weight of 359.34 g/mol, XLogP of -0.16, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methoxycarbonylamino)hexanoate is sourced from PubChem (CID 21042081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).