C23H41N5O4 — CID 21042087
2,6-bis(tert-butylamino)-N-[3-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]propyl]hexanamide (PubChem CID 21042087) has the molecular formula C23H41N5O4 and a molecular weight of 451.61 g/mol. Its IUPAC name is 2,6-bis(tert-butylamino)-N-[3-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]propyl]hexanamide.
| Compound Name | 2,6-bis(tert-butylamino)-N-[3-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]propyl]hexanamide |
|---|---|
| PubChem CID | 21042087 |
| Molecular Formula | C23H41N5O4 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.32 |
| IUPAC Name | 2,6-bis(tert-butylamino)-N-[3-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]propyl]hexanamide |
| SMILES | CC(C)(C)NCCCCC(NC(C)(C)C)C(=O)NCCCNC(=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C23H41N5O4/c1-22(2,3)26-15-8-7-10-17(27-23(4,5)6)21(32)25-14-9-13-24-18(29)16-28-19(30)11-12-20(28)31/h11-12,17,26-27H,7-10,13-16H2,1-6H3,(H,24,29)(H,25,32) |
| InChIKey | DJTJHGSMWICFST-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|