C30H39N3O5S — CID 21043064
pent-4-enyl N-[4-[5,5-dimethyl-4-[(2-methylphenyl)methylcarbamoyl]-1,3-thiazolidin-3-yl]-3-hydroxy-4-oxo-1-phenylbutan-2-yl]carbamate (PubChem CID 21043064) has the molecular formula C30H39N3O5S and a molecular weight of 553.73 g/mol. Its IUPAC name is pent-4-enyl N-[4-[5,5-dimethyl-4-[(2-methylphenyl)methylcarbamoyl]-1,3-thiazolidin-3-yl]-3-hydroxy-4-oxo-1-phenylbutan-2-yl]carbamate.
| Compound Name | pent-4-enyl N-[4-[5,5-dimethyl-4-[(2-methylphenyl)methylcarbamoyl]-1,3-thiazolidin-3-yl]-3-hydroxy-4-oxo-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 21043064 |
| Molecular Formula | C30H39N3O5S |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | pent-4-enyl N-[4-[5,5-dimethyl-4-[(2-methylphenyl)methylcarbamoyl]-1,3-thiazolidin-3-yl]-3-hydroxy-4-oxo-1-phenylbutan-2-yl]carbamate |
| SMILES | C=CCCCOC(=O)NC(Cc1ccccc1)C(O)C(=O)N1CSC(C)(C)C1C(=O)NCc1ccccc1C |
| InChI | InChI=1S/C30H39N3O5S/c1-5-6-12-17-38-29(37)32-24(18-22-14-8-7-9-15-22)25(34)28(36)33-20-39-30(3,4)26(33)27(35)31-19-23-16-11-10-13-21(23)2/h5,7-11,13-16,24-26,34H,1,6,12,17-20H2,2-4H3,(H,31,35)(H,32,37) |
| InChIKey | RWZUIYUDIGXFOT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|