About 1-[1-(3,5-diethylphenyl)propyl]-3,5-diethylbenzene
1-[1-(3,5-diethylphenyl)propyl]-3,5-diethylbenzene (PubChem CID 21043177) has the molecular formula C23H32
and a molecular weight of 308.51 g/mol. Its IUPAC name is 1-[1-(3,5-diethylphenyl)propyl]-3,5-diethylbenzene.
Molecular Properties
| Compound Name | 1-[1-(3,5-diethylphenyl)propyl]-3,5-diethylbenzene |
| PubChem CID | 21043177 |
| Molecular Formula | C23H32 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 1-[1-(3,5-diethylphenyl)propyl]-3,5-diethylbenzene |
| SMILES | CCc1cc(CC)cc(C(CC)c2cc(CC)cc(CC)c2)c1 |
| InChI | InChI=1S/C23H32/c1-6-17-11-18(7-2)14-21(13-17)23(10-5)22-15-19(8-3)12-20(9-4)16-22/h11-16,23H,6-10H2,1-5H3 |
| InChIKey | CCGROAHTVRSBNJ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-[1-(3,5-diethylphenyl)propyl]-3,5-diethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(3,5-diethylphenyl)propyl]-3,5-diethylbenzene?
The IUPAC name of 1-[1-(3,5-diethylphenyl)propyl]-3,5-diethylbenzene (CID 21043177) is 1-[1-(3,5-diethylphenyl)propyl]-3,5-diethylbenzene.
What is the SMILES notation for 1-[1-(3,5-diethylphenyl)propyl]-3,5-diethylbenzene?
The canonical SMILES for 1-[1-(3,5-diethylphenyl)propyl]-3,5-diethylbenzene is CCc1cc(CC)cc(C(CC)c2cc(CC)cc(CC)c2)c1.
What is the InChIKey of 1-[1-(3,5-diethylphenyl)propyl]-3,5-diethylbenzene?
The InChIKey is CCGROAHTVRSBNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32/c1-6-17-11-18(7-2)14-21(13-17)23(10-5)22-15-19(8-3)12-20(9-4)16-22/h11-16,23H,6-10H2,1-5H3.
What are the key properties of 1-[1-(3,5-diethylphenyl)propyl]-3,5-diethylbenzene?
1-[1-(3,5-diethylphenyl)propyl]-3,5-diethylbenzene has a molecular weight of 308.51 g/mol, XLogP of 6.48, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(3,5-diethylphenyl)propyl]-3,5-diethylbenzene is sourced from PubChem (CID 21043177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).