C27H25NO8S — CID 21043511
4-[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-2-hydroxyacridin-10-ium-10-yl]butane-1-sulfonate (PubChem CID 21043511) has the molecular formula C27H25NO8S and a molecular weight of 523.56 g/mol. Its IUPAC name is 4-[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-2-hydroxyacridin-10-ium-10-yl]butane-1-sulfonate.
| Compound Name | 4-[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-2-hydroxyacridin-10-ium-10-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 21043511 |
| Molecular Formula | C27H25NO8S |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | 4-[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-2-hydroxyacridin-10-ium-10-yl]butane-1-sulfonate |
| SMILES | Cc1cc(C(=O)O)cc(C)c1OC(=O)c1c2ccccc2[n+](CCCCS(=O)(=O)[O-])c2ccc(O)cc12 |
| InChI | InChI=1S/C27H25NO8S/c1-16-13-18(26(30)31)14-17(2)25(16)36-27(32)24-20-7-3-4-8-22(20)28(11-5-6-12-37(33,34)35)23-10-9-19(29)15-21(23)24/h3-4,7-10,13-15H,5-6,11-12H2,1-2H3,(H2-,29,30,31,32,33,34,35) |
| InChIKey | VJQZLERQNPANAF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|