C8H16O6 — CID 21043551
(2R,3R,4R)-3,4,5-trihydroxy-2-(2-methoxyethoxy)pentanal (PubChem CID 21043551) has the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. Its IUPAC name is (2R,3R,4R)-3,4,5-trihydroxy-2-(2-methoxyethoxy)pentanal.
| Compound Name | (2R,3R,4R)-3,4,5-trihydroxy-2-(2-methoxyethoxy)pentanal |
|---|---|
| PubChem CID | 21043551 |
| Molecular Formula | C8H16O6 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | (2R,3R,4R)-3,4,5-trihydroxy-2-(2-methoxyethoxy)pentanal |
| SMILES | COCCO[C@@H](C=O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H16O6/c1-13-2-3-14-7(5-10)8(12)6(11)4-9/h5-9,11-12H,2-4H2,1H3/t6-,7+,8-/m1/s1 |
| InChIKey | WYGGONZRIKQSRE-GJMOJQLCSA-N |
| XLogP | -2.07 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|