C8H17N2+ — CID 21043719
1,5-dimethyl-3,4,6,7-tetrahydro-2H-1,5-diazocin-1-ium (PubChem CID 21043719) has the molecular formula C8H17N2+ and a molecular weight of 141.24 g/mol. Its IUPAC name is 1,5-dimethyl-3,4,6,7-tetrahydro-2H-1,5-diazocin-1-ium.
| Compound Name | 1,5-dimethyl-3,4,6,7-tetrahydro-2H-1,5-diazocin-1-ium |
|---|---|
| PubChem CID | 21043719 |
| Molecular Formula | C8H17N2+ |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.14 |
| IUPAC Name | 1,5-dimethyl-3,4,6,7-tetrahydro-2H-1,5-diazocin-1-ium |
| SMILES | CN1CC/C=[N+](/C)CCC1 |
| InChI | InChI=1S/C8H17N2/c1-9-5-3-7-10(2)8-4-6-9/h5H,3-4,6-8H2,1-2H3/q+1/b9-5- |
| InChIKey | BRWQHIQHHGQUND-UITAMQMPSA-N |
| XLogP | 0.43 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|