About 4-(ethylaminomethyl)hexan-2-one;N-methanidylethanamine;tungsten(2+)
4-(ethylaminomethyl)hexan-2-one;N-methanidylethanamine;tungsten(2+) (PubChem CID 21043817) has the molecular formula C12H26N2OW
and a molecular weight of 398.19 g/mol. Its IUPAC name is 4-(ethylaminomethyl)hexan-2-one;N-methanidylethanamine;tungsten(2+).
Molecular Properties
| Compound Name | 4-(ethylaminomethyl)hexan-2-one;N-methanidylethanamine;tungsten(2+) |
| PubChem CID | 21043817 |
| Molecular Formula | C12H26N2OW |
| Molecular Weight | 398.19 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 4-(ethylaminomethyl)hexan-2-one;N-methanidylethanamine;tungsten(2+) |
| SMILES | [CH2-]C(=O)CC(CC)CNCC.[CH2-]NCC.[W+2] |
| InChI | InChI=1S/C9H18NO.C3H8N.W/c1-4-9(6-8(3)11)7-10-5-2;1-3-4-2;/h9-10H,3-7H2,1-2H3;4H,2-3H2,1H3;/q2*-1;+2 |
| InChIKey | BIDQHBHVNYPPNL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.19 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-(ethylaminomethyl)hexan-2-one;N-methanidylethanamine;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethylaminomethyl)hexan-2-one;N-methanidylethanamine;tungsten(2+)?
The IUPAC name of 4-(ethylaminomethyl)hexan-2-one;N-methanidylethanamine;tungsten(2+) (CID 21043817) is 4-(ethylaminomethyl)hexan-2-one;N-methanidylethanamine;tungsten(2+).
What is the SMILES notation for 4-(ethylaminomethyl)hexan-2-one;N-methanidylethanamine;tungsten(2+)?
The canonical SMILES for 4-(ethylaminomethyl)hexan-2-one;N-methanidylethanamine;tungsten(2+) is [CH2-]C(=O)CC(CC)CNCC.[CH2-]NCC.[W+2].
What is the InChIKey of 4-(ethylaminomethyl)hexan-2-one;N-methanidylethanamine;tungsten(2+)?
The InChIKey is BIDQHBHVNYPPNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18NO.C3H8N.W/c1-4-9(6-8(3)11)7-10-5-2;1-3-4-2;/h9-10H,3-7H2,1-2H3;4H,2-3H2,1H3;/q2*-1;+2.
What are the key properties of 4-(ethylaminomethyl)hexan-2-one;N-methanidylethanamine;tungsten(2+)?
4-(ethylaminomethyl)hexan-2-one;N-methanidylethanamine;tungsten(2+) has a molecular weight of 398.19 g/mol, XLogP of 1.80, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethylaminomethyl)hexan-2-one;N-methanidylethanamine;tungsten(2+) is sourced from PubChem (CID 21043817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).