About 5-[ethyl(methyl)amino]-4-methylpentan-2-one;N-methanidyl-N-methylethanamine;tungsten(2+)
5-[ethyl(methyl)amino]-4-methylpentan-2-one;N-methanidyl-N-methylethanamine;tungsten(2+) (PubChem CID 21043834) has the molecular formula C13H28N2OW
and a molecular weight of 412.22 g/mol. Its IUPAC name is 5-[ethyl(methyl)amino]-4-methylpentan-2-one;N-methanidyl-N-methylethanamine;tungsten(2+).
Molecular Properties
| Compound Name | 5-[ethyl(methyl)amino]-4-methylpentan-2-one;N-methanidyl-N-methylethanamine;tungsten(2+) |
| PubChem CID | 21043834 |
| Molecular Formula | C13H28N2OW |
| Molecular Weight | 412.22 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 5-[ethyl(methyl)amino]-4-methylpentan-2-one;N-methanidyl-N-methylethanamine;tungsten(2+) |
| SMILES | [CH2-]C(=O)CC(C)CN(C)CC.[CH2-]N(C)CC.[W+2] |
| InChI | InChI=1S/C9H18NO.C4H10N.W/c1-5-10(4)7-8(2)6-9(3)11;1-4-5(2)3;/h8H,3,5-7H2,1-2,4H3;2,4H2,1,3H3;/q2*-1;+2 |
| InChIKey | HVLYTMWORPCMIT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-[ethyl(methyl)amino]-4-methylpentan-2-one;N-methanidyl-N-methylethanamine;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[ethyl(methyl)amino]-4-methylpentan-2-one;N-methanidyl-N-methylethanamine;tungsten(2+)?
The IUPAC name of 5-[ethyl(methyl)amino]-4-methylpentan-2-one;N-methanidyl-N-methylethanamine;tungsten(2+) (CID 21043834) is 5-[ethyl(methyl)amino]-4-methylpentan-2-one;N-methanidyl-N-methylethanamine;tungsten(2+).
What is the SMILES notation for 5-[ethyl(methyl)amino]-4-methylpentan-2-one;N-methanidyl-N-methylethanamine;tungsten(2+)?
The canonical SMILES for 5-[ethyl(methyl)amino]-4-methylpentan-2-one;N-methanidyl-N-methylethanamine;tungsten(2+) is [CH2-]C(=O)CC(C)CN(C)CC.[CH2-]N(C)CC.[W+2].
What is the InChIKey of 5-[ethyl(methyl)amino]-4-methylpentan-2-one;N-methanidyl-N-methylethanamine;tungsten(2+)?
The InChIKey is HVLYTMWORPCMIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18NO.C4H10N.W/c1-5-10(4)7-8(2)6-9(3)11;1-4-5(2)3;/h8H,3,5-7H2,1-2,4H3;2,4H2,1,3H3;/q2*-1;+2.
What are the key properties of 5-[ethyl(methyl)amino]-4-methylpentan-2-one;N-methanidyl-N-methylethanamine;tungsten(2+)?
5-[ethyl(methyl)amino]-4-methylpentan-2-one;N-methanidyl-N-methylethanamine;tungsten(2+) has a molecular weight of 412.22 g/mol, XLogP of 2.09, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[ethyl(methyl)amino]-4-methylpentan-2-one;N-methanidyl-N-methylethanamine;tungsten(2+) is sourced from PubChem (CID 21043834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).