About [2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methanol
[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methanol (PubChem CID 21044034) has the molecular formula C5H8F2O2
and a molecular weight of 138.11 g/mol. Its IUPAC name is [2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methanol.
Molecular Properties
| Compound Name | [2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methanol |
| PubChem CID | 21044034 |
| Molecular Formula | C5H8F2O2 |
| Molecular Weight | 138.11 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | [2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methanol |
| SMILES | OCC1C(CO)C1(F)F |
| InChI | InChI=1S/C5H8F2O2/c6-5(7)3(1-8)4(5)2-9/h3-4,8-9H,1-2H2 |
| InChIKey | KSYJIMLAIWGZHF-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.11 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methanol?
The IUPAC name of [2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methanol (CID 21044034) is [2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methanol.
What is the SMILES notation for [2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methanol?
The canonical SMILES for [2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methanol is OCC1C(CO)C1(F)F.
What is the InChIKey of [2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methanol?
The InChIKey is KSYJIMLAIWGZHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F2O2/c6-5(7)3(1-8)4(5)2-9/h3-4,8-9H,1-2H2.
What are the key properties of [2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methanol?
[2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methanol has a molecular weight of 138.11 g/mol, XLogP of -0.15, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-difluoro-3-(hydroxymethyl)cyclopropyl]methanol is sourced from PubChem (CID 21044034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).