About 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;carbanide;platinum
2-(3H-1-benzothiophen-3-id-2-yl)pyridine;carbanide;platinum (PubChem CID 21044181) has the molecular formula C15H14NPtS-3
and a molecular weight of 435.43 g/mol. Its IUPAC name is 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;carbanide;platinum.
Molecular Properties
| Compound Name | 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;carbanide;platinum |
| PubChem CID | 21044181 |
| Molecular Formula | C15H14NPtS-3 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;carbanide;platinum |
| SMILES | [CH3-].[CH3-].[Pt].[c-]1c(-c2ccccn2)sc2ccccc12 |
| InChI | InChI=1S/C13H8NS.2CH3.Pt/c1-2-7-12-10(5-1)9-13(15-12)11-6-3-4-8-14-11;;;/h1-8H;2*1H3;/q3*-1; |
| InChIKey | MVZQBDRFZVCKGW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;carbanide;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;carbanide;platinum?
The IUPAC name of 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;carbanide;platinum (CID 21044181) is 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;carbanide;platinum.
What is the SMILES notation for 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;carbanide;platinum?
The canonical SMILES for 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;carbanide;platinum is [CH3-].[CH3-].[Pt].[c-]1c(-c2ccccn2)sc2ccccc12.
What is the InChIKey of 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;carbanide;platinum?
The InChIKey is MVZQBDRFZVCKGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8NS.2CH3.Pt/c1-2-7-12-10(5-1)9-13(15-12)11-6-3-4-8-14-11;;;/h1-8H;2*1H3;/q3*-1;.
What are the key properties of 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;carbanide;platinum?
2-(3H-1-benzothiophen-3-id-2-yl)pyridine;carbanide;platinum has a molecular weight of 435.43 g/mol, XLogP of 4.66, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;carbanide;platinum is sourced from PubChem (CID 21044181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).