methyl 3-(2,4-dichloropyrimidin-5-yl)-2-phenylpropanoate

C14H12Cl2N2O2 — CID 21044322

IUPACmethyl 3-(2,4-dichloropyrimidin-5-yl)-2-phenylpropanoate
SMILESCOC(=O)C(Cc1cnc(Cl)nc1Cl)c1ccccc1
InChIInChI=1S/C14H12Cl2N2O2/c1-20-13(19)11(9-5-3-2-4-6-9)7-10-8-17-14(16)18-12(10)15/h2-6,8,11H,7H2,1H3
InChIKeyBBUHOXYFMXFEHO-UHFFFAOYSA-N
MW311.17 g/mol
LogP3.28
Rot. Bonds4

About methyl 3-(2,4-dichloropyrimidin-5-yl)-2-phenylpropanoate

methyl 3-(2,4-dichloropyrimidin-5-yl)-2-phenylpropanoate (PubChem CID 21044322) has the molecular formula C14H12Cl2N2O2 and a molecular weight of 311.17 g/mol. Its IUPAC name is methyl 3-(2,4-dichloropyrimidin-5-yl)-2-phenylpropanoate.

Molecular Properties

Compound Namemethyl 3-(2,4-dichloropyrimidin-5-yl)-2-phenylpropanoate
PubChem CID21044322
Molecular FormulaC14H12Cl2N2O2
Molecular Weight311.17 g/mol
Exact Mass310.03
IUPAC Namemethyl 3-(2,4-dichloropyrimidin-5-yl)-2-phenylpropanoate
SMILESCOC(=O)C(Cc1cnc(Cl)nc1Cl)c1ccccc1
InChIInChI=1S/C14H12Cl2N2O2/c1-20-13(19)11(9-5-3-2-4-6-9)7-10-8-17-14(16)18-12(10)15/h2-6,8,11H,7H2,1H3
InChIKeyBBUHOXYFMXFEHO-UHFFFAOYSA-N
XLogP3.28
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500311.17
LogP ≤ 53.28
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-(2,4-dichloropyrimidin-5-yl)-2-phenylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2,4-dichloropyrimidin-5-yl)-2-phenylpropanoate?
The IUPAC name of methyl 3-(2,4-dichloropyrimidin-5-yl)-2-phenylpropanoate (CID 21044322) is methyl 3-(2,4-dichloropyrimidin-5-yl)-2-phenylpropanoate.
What is the SMILES notation for methyl 3-(2,4-dichloropyrimidin-5-yl)-2-phenylpropanoate?
The canonical SMILES for methyl 3-(2,4-dichloropyrimidin-5-yl)-2-phenylpropanoate is COC(=O)C(Cc1cnc(Cl)nc1Cl)c1ccccc1.
What is the InChIKey of methyl 3-(2,4-dichloropyrimidin-5-yl)-2-phenylpropanoate?
The InChIKey is BBUHOXYFMXFEHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Cl2N2O2/c1-20-13(19)11(9-5-3-2-4-6-9)7-10-8-17-14(16)18-12(10)15/h2-6,8,11H,7H2,1H3.
What are the key properties of methyl 3-(2,4-dichloropyrimidin-5-yl)-2-phenylpropanoate?
methyl 3-(2,4-dichloropyrimidin-5-yl)-2-phenylpropanoate has a molecular weight of 311.17 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,4-dichloropyrimidin-5-yl)-2-phenylpropanoate is sourced from PubChem (CID 21044322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).