C11H18N2O3 — CID 21044340
2-[4-(hydroxymethyl)-2,2,5-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]acetonitrile (PubChem CID 21044340) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-[4-(hydroxymethyl)-2,2,5-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]acetonitrile.
| Compound Name | 2-[4-(hydroxymethyl)-2,2,5-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]acetonitrile |
|---|---|
| PubChem CID | 21044340 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 2-[4-(hydroxymethyl)-2,2,5-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]acetonitrile |
| SMILES | CN1C(CO)C2OC(C)(C)OC2C1CC#N |
| InChI | InChI=1S/C11H18N2O3/c1-11(2)15-9-7(4-5-12)13(3)8(6-14)10(9)16-11/h7-10,14H,4,6H2,1-3H3 |
| InChIKey | UAVJTTDLOXEOON-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |