C16H23N5O2 — CID 21044353
7-(6-ethyl-2,2,5-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl)-5H-pyrrolo[3,2-d]pyrimidin-4-amine (PubChem CID 21044353) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 7-(6-ethyl-2,2,5-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl)-5H-pyrrolo[3,2-d]pyrimidin-4-amine.
| Compound Name | 7-(6-ethyl-2,2,5-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl)-5H-pyrrolo[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 21044353 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 7-(6-ethyl-2,2,5-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl)-5H-pyrrolo[3,2-d]pyrimidin-4-amine |
| SMILES | CCC1C2OC(C)(C)OC2C(c2c[nH]c3c(N)ncnc23)N1C |
| InChI | InChI=1S/C16H23N5O2/c1-5-9-13-14(23-16(2,3)22-13)12(21(9)4)8-6-18-11-10(8)19-7-20-15(11)17/h6-7,9,12-14,18H,5H2,1-4H3,(H2,17,19,20) |
| InChIKey | JMNUURFWABOOBJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 89.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |