C13H14F3N3O — CID 21044383
2,2,2-trifluoro-1-[(9R,13R)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-4-yl]ethanone (PubChem CID 21044383) has the molecular formula C13H14F3N3O and a molecular weight of 285.27 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[(9R,13R)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-4-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[(9R,13R)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-4-yl]ethanone |
|---|---|
| PubChem CID | 21044383 |
| Molecular Formula | C13H14F3N3O |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2,2,2-trifluoro-1-[(9R,13R)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-4-yl]ethanone |
| SMILES | C[C@@H]1CNC[C@H]2Cc3ccc(C(=O)C(F)(F)F)nc3N21 |
| InChI | InChI=1S/C13H14F3N3O/c1-7-5-17-6-9-4-8-2-3-10(11(20)13(14,15)16)18-12(8)19(7)9/h2-3,7,9,17H,4-6H2,1H3/t7-,9-/m1/s1 |
| InChIKey | HJFGZBJISWWICI-VXNVDRBHSA-N |
| XLogP | 1.55 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |