C13H19N3O — CID 21044398
(1S)-1-[(9R,13R)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-4-yl]ethanol (PubChem CID 21044398) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is (1S)-1-[(9R,13R)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-4-yl]ethanol.
| Compound Name | (1S)-1-[(9R,13R)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-4-yl]ethanol |
|---|---|
| PubChem CID | 21044398 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | (1S)-1-[(9R,13R)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-4-yl]ethanol |
| SMILES | C[C@H](O)c1ccc2c(n1)N1[C@@H](CNC[C@H]1C)C2 |
| InChI | InChI=1S/C13H19N3O/c1-8-6-14-7-11-5-10-3-4-12(9(2)17)15-13(10)16(8)11/h3-4,8-9,11,14,17H,5-7H2,1-2H3/t8-,9+,11-/m1/s1 |
| InChIKey | VFLUBEQSNNICTK-WCABBAIRSA-N |
| XLogP | 0.86 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |