C19H25F6N3O5 — CID 21044420
(9R,13R)-4-(1-methoxypropyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;bis(2,2,2-trifluoroacetic acid) (PubChem CID 21044420) has the molecular formula C19H25F6N3O5 and a molecular weight of 489.41 g/mol. Its IUPAC name is (9R,13R)-4-(1-methoxypropyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (9R,13R)-4-(1-methoxypropyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 21044420 |
| Molecular Formula | C19H25F6N3O5 |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | (9R,13R)-4-(1-methoxypropyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCC(OC)c1ccc2c(n1)N1[C@@H](CNC[C@H]1C)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N3O.2C2HF3O2/c1-4-14(19-3)13-6-5-11-7-12-9-16-8-10(2)18(12)15(11)17-13;2*3-2(4,5)1(6)7/h5-6,10,12,14,16H,4,7-9H2,1-3H3;2*(H,6,7)/t10-,12-,14?;;/m1../s1 |
| InChIKey | IDIFQOFFZILLRO-XHTOIFSHSA-N |
| XLogP | 3.17 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |