C18H27N3O3 — CID 21044425
tert-butyl (9R,13R)-4-ethoxy-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylate (PubChem CID 21044425) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is tert-butyl (9R,13R)-4-ethoxy-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylate.
| Compound Name | tert-butyl (9R,13R)-4-ethoxy-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylate |
|---|---|
| PubChem CID | 21044425 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | tert-butyl (9R,13R)-4-ethoxy-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylate |
| SMILES | CCOc1ccc2c(n1)N1[C@H](C2)CN(C(=O)OC(C)(C)C)C[C@H]1C |
| InChI | InChI=1S/C18H27N3O3/c1-6-23-15-8-7-13-9-14-11-20(17(22)24-18(3,4)5)10-12(2)21(14)16(13)19-15/h7-8,12,14H,6,9-11H2,1-5H3/t12-,14-/m1/s1 |
| InChIKey | QKALYXJMPWRSFN-TZMCWYRMSA-N |
| XLogP | 2.85 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |