C33H22F6S6 — CID 21044685
2-[3,3,4,4,5,5-hexafluoro-2-[3-methyl-5-[5-(5-methylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]cyclopenten-1-yl]-3-methyl-5-[5-(5-methylthiophen-2-yl)thiophen-2-yl]thiophene (PubChem CID 21044685) has the molecular formula C33H22F6S6 and a molecular weight of 724.93 g/mol. Its IUPAC name is 2-[3,3,4,4,5,5-hexafluoro-2-[3-methyl-5-[5-(5-methylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]cyclopenten-1-yl]-3-methyl-5-[5-(5-methylthiophen-2-yl)thiophen-2-yl]thiophene.
| Compound Name | 2-[3,3,4,4,5,5-hexafluoro-2-[3-methyl-5-[5-(5-methylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]cyclopenten-1-yl]-3-methyl-5-[5-(5-methylthiophen-2-yl)thiophen-2-yl]thiophene |
|---|---|
| PubChem CID | 21044685 |
| Molecular Formula | C33H22F6S6 |
| Molecular Weight | 724.93 g/mol |
| Exact Mass | 723.99 |
| IUPAC Name | 2-[3,3,4,4,5,5-hexafluoro-2-[3-methyl-5-[5-(5-methylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]cyclopenten-1-yl]-3-methyl-5-[5-(5-methylthiophen-2-yl)thiophen-2-yl]thiophene |
| SMILES | Cc1ccc(-c2ccc(-c3cc(C)c(C4=C(c5sc(-c6ccc(-c7ccc(C)s7)s6)cc5C)C(F)(F)C(F)(F)C4(F)F)s3)s2)s1 |
| InChI | InChI=1S/C33H22F6S6/c1-15-13-25(23-11-9-21(42-23)19-7-5-17(3)40-19)44-29(15)27-28(32(36,37)33(38,39)31(27,34)35)30-16(2)14-26(45-30)24-12-10-22(43-24)20-8-6-18(4)41-20/h5-14H,1-4H3 |
| InChIKey | MOMBBFSBDDYXOS-UHFFFAOYSA-N |
| XLogP | 13.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.93 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|