C33H26F6O2S2 — CID 21044695
2-(4-ethoxyphenyl)-5-[2-[5-(4-ethynoxyphenyl)-3,4-dimethylthiophen-2-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,4-dimethylthiophene (PubChem CID 21044695) has the molecular formula C33H26F6O2S2 and a molecular weight of 632.69 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-5-[2-[5-(4-ethynoxyphenyl)-3,4-dimethylthiophen-2-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,4-dimethylthiophene.
| Compound Name | 2-(4-ethoxyphenyl)-5-[2-[5-(4-ethynoxyphenyl)-3,4-dimethylthiophen-2-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,4-dimethylthiophene |
|---|---|
| PubChem CID | 21044695 |
| Molecular Formula | C33H26F6O2S2 |
| Molecular Weight | 632.69 g/mol |
| Exact Mass | 632.13 |
| IUPAC Name | 2-(4-ethoxyphenyl)-5-[2-[5-(4-ethynoxyphenyl)-3,4-dimethylthiophen-2-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,4-dimethylthiophene |
| SMILES | C#COc1ccc(-c2sc(C3=C(c4sc(-c5ccc(OCC)cc5)c(C)c4C)C(F)(F)C(F)(F)C3(F)F)c(C)c2C)cc1 |
| InChI | InChI=1S/C33H26F6O2S2/c1-7-40-23-13-9-21(10-14-23)27-17(3)19(5)29(42-27)25-26(32(36,37)33(38,39)31(25,34)35)30-20(6)18(4)28(43-30)22-11-15-24(16-12-22)41-8-2/h1,9-16H,8H2,2-6H3 |
| InChIKey | UTMKWGAPNRJSFQ-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.69 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|