C17H14F6O2S2 — CID 21044709
3-[2-(2,5-dimethyl-1-oxothiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-dimethylthiophene 1-oxide (PubChem CID 21044709) has the molecular formula C17H14F6O2S2 and a molecular weight of 428.42 g/mol. Its IUPAC name is 3-[2-(2,5-dimethyl-1-oxothiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-dimethylthiophene 1-oxide.
| Compound Name | 3-[2-(2,5-dimethyl-1-oxothiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-dimethylthiophene 1-oxide |
|---|---|
| PubChem CID | 21044709 |
| Molecular Formula | C17H14F6O2S2 |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 3-[2-(2,5-dimethyl-1-oxothiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-dimethylthiophene 1-oxide |
| SMILES | CC1=CC(C2=C(C3=C(C)S(=O)C(C)=C3)C(F)(F)C(F)(F)C2(F)F)=C(C)S1=O |
| InChI | InChI=1S/C17H14F6O2S2/c1-7-5-11(9(3)26(7)24)13-14(12-6-8(2)27(25)10(12)4)16(20,21)17(22,23)15(13,18)19/h5-6H,1-4H3 |
| InChIKey | NQIMXNGMXZQVPL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|