C14H18N4O2S — CID 2104479
N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]methanesulfonamide (PubChem CID 2104479) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]methanesulfonamide.
| Compound Name | N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 2104479 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2nnc3n2CCCCC3)cc1 |
| InChI | InChI=1S/C14H18N4O2S/c1-21(19,20)17-12-8-6-11(7-9-12)14-16-15-13-5-3-2-4-10-18(13)14/h6-9,17H,2-5,10H2,1H3 |
| InChIKey | DLBAZZHSIFNMKH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |