About 1-[benzenesulfonyl(diazo)methyl]sulfonyl-2,4-dimethylbenzene
1-[benzenesulfonyl(diazo)methyl]sulfonyl-2,4-dimethylbenzene (PubChem CID 21045006) has the molecular formula C15H14N2O4S2
and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-[benzenesulfonyl(diazo)methyl]sulfonyl-2,4-dimethylbenzene.
Molecular Properties
| Compound Name | 1-[benzenesulfonyl(diazo)methyl]sulfonyl-2,4-dimethylbenzene |
| PubChem CID | 21045006 |
| Molecular Formula | C15H14N2O4S2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 1-[benzenesulfonyl(diazo)methyl]sulfonyl-2,4-dimethylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)C(=[N+]=[N-])S(=O)(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C15H14N2O4S2/c1-11-8-9-14(12(2)10-11)23(20,21)15(17-16)22(18,19)13-6-4-3-5-7-13/h3-10H,1-2H3 |
| InChIKey | QUBFAPUPIVLVQQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 104.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-[benzenesulfonyl(diazo)methyl]sulfonyl-2,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[benzenesulfonyl(diazo)methyl]sulfonyl-2,4-dimethylbenzene?
The IUPAC name of 1-[benzenesulfonyl(diazo)methyl]sulfonyl-2,4-dimethylbenzene (CID 21045006) is 1-[benzenesulfonyl(diazo)methyl]sulfonyl-2,4-dimethylbenzene.
What is the SMILES notation for 1-[benzenesulfonyl(diazo)methyl]sulfonyl-2,4-dimethylbenzene?
The canonical SMILES for 1-[benzenesulfonyl(diazo)methyl]sulfonyl-2,4-dimethylbenzene is Cc1ccc(S(=O)(=O)C(=[N+]=[N-])S(=O)(=O)c2ccccc2)c(C)c1.
What is the InChIKey of 1-[benzenesulfonyl(diazo)methyl]sulfonyl-2,4-dimethylbenzene?
The InChIKey is QUBFAPUPIVLVQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O4S2/c1-11-8-9-14(12(2)10-11)23(20,21)15(17-16)22(18,19)13-6-4-3-5-7-13/h3-10H,1-2H3.
What are the key properties of 1-[benzenesulfonyl(diazo)methyl]sulfonyl-2,4-dimethylbenzene?
1-[benzenesulfonyl(diazo)methyl]sulfonyl-2,4-dimethylbenzene has a molecular weight of 350.42 g/mol, XLogP of 2.14, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[benzenesulfonyl(diazo)methyl]sulfonyl-2,4-dimethylbenzene is sourced from PubChem (CID 21045006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).