C38H26F6N2O8 — CID 21045058
2-[[5-[2-[3-[[4-(4-acetylphenoxy)benzoyl]amino]-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]carbamoyl]benzoic acid (PubChem CID 21045058) has the molecular formula C38H26F6N2O8 and a molecular weight of 752.62 g/mol. Its IUPAC name is 2-[[5-[2-[3-[[4-(4-acetylphenoxy)benzoyl]amino]-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[5-[2-[3-[[4-(4-acetylphenoxy)benzoyl]amino]-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 21045058 |
| Molecular Formula | C38H26F6N2O8 |
| Molecular Weight | 752.62 g/mol |
| Exact Mass | 752.16 |
| IUPAC Name | 2-[[5-[2-[3-[[4-(4-acetylphenoxy)benzoyl]amino]-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]carbamoyl]benzoic acid |
| SMILES | CC(=O)c1ccc(Oc2ccc(C(=O)Nc3cc(C(c4ccc(O)c(NC(=O)c5ccccc5C(=O)O)c4)(C(F)(F)F)C(F)(F)F)ccc3O)cc2)cc1 |
| InChI | InChI=1S/C38H26F6N2O8/c1-20(47)21-6-12-25(13-7-21)54-26-14-8-22(9-15-26)33(50)45-29-18-23(10-16-31(29)48)36(37(39,40)41,38(42,43)44)24-11-17-32(49)30(19-24)46-34(51)27-4-2-3-5-28(27)35(52)53/h2-19,48-49H,1H3,(H,45,50)(H,46,51)(H,52,53) |
| InChIKey | XSHTXHDWSPZQIL-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 162.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.62 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|