C31H24F6N2O4 — CID 21045066
4-(4-acetylphenoxy)-N-[5-[2-(3-amino-4-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]benzamide (PubChem CID 21045066) has the molecular formula C31H24F6N2O4 and a molecular weight of 602.53 g/mol. Its IUPAC name is 4-(4-acetylphenoxy)-N-[5-[2-(3-amino-4-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]benzamide.
| Compound Name | 4-(4-acetylphenoxy)-N-[5-[2-(3-amino-4-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]benzamide |
|---|---|
| PubChem CID | 21045066 |
| Molecular Formula | C31H24F6N2O4 |
| Molecular Weight | 602.53 g/mol |
| Exact Mass | 602.16 |
| IUPAC Name | 4-(4-acetylphenoxy)-N-[5-[2-(3-amino-4-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]benzamide |
| SMILES | CC(=O)c1ccc(Oc2ccc(C(=O)Nc3cc(C(c4ccc(C)c(N)c4)(C(F)(F)F)C(F)(F)F)ccc3O)cc2)cc1 |
| InChI | InChI=1S/C31H24F6N2O4/c1-17-3-8-21(15-25(17)38)29(30(32,33)34,31(35,36)37)22-9-14-27(41)26(16-22)39-28(42)20-6-12-24(13-7-20)43-23-10-4-19(5-11-23)18(2)40/h3-16,41H,38H2,1-2H3,(H,39,42) |
| InChIKey | SUSTTWUXFCBTGY-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.53 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|