C20H27F2NO2S — CID 21045357
1-[4,4-difluoro-4-(phenylsulfonimidoyl)butan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 21045357) has the molecular formula C20H27F2NO2S and a molecular weight of 383.50 g/mol. Its IUPAC name is 1-[4,4-difluoro-4-(phenylsulfonimidoyl)butan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | 1-[4,4-difluoro-4-(phenylsulfonimidoyl)butan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 21045357 |
| Molecular Formula | C20H27F2NO2S |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 1-[4,4-difluoro-4-(phenylsulfonimidoyl)butan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | [H]N=S(=O)(c1ccccc1)C(F)(F)CC(C)C1CCC2C(=O)CCCC21C |
| InChI | InChI=1S/C20H27F2NO2S/c1-14(16-10-11-17-18(24)9-6-12-19(16,17)2)13-20(21,22)26(23,25)15-7-4-3-5-8-15/h3-5,7-8,14,16-17,23H,6,9-13H2,1-2H3 |
| InChIKey | JPVJKLAUXOFVHR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |