C16H20F3N3O2 — CID 21045424
4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-5-methyl-1,4-diazepan-2-one (PubChem CID 21045424) has the molecular formula C16H20F3N3O2 and a molecular weight of 343.35 g/mol. Its IUPAC name is 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-5-methyl-1,4-diazepan-2-one.
| Compound Name | 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-5-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 21045424 |
| Molecular Formula | C16H20F3N3O2 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-5-methyl-1,4-diazepan-2-one |
| SMILES | CC1CCNC(=O)CN1C(=O)C[C@H](N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C16H20F3N3O2/c1-9-2-3-21-15(23)8-22(9)16(24)6-11(20)4-10-5-13(18)14(19)7-12(10)17/h5,7,9,11H,2-4,6,8,20H2,1H3,(H,21,23)/t9?,11-/m1/s1 |
| InChIKey | WDVOWOZFVGQRFP-HCCKASOXSA-N |
| XLogP | 1.10 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|