C33H38F3NO3 — CID 21045566
[3-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-yl]methanone (PubChem CID 21045566) has the molecular formula C33H38F3NO3 and a molecular weight of 553.67 g/mol. Its IUPAC name is [3-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-yl]methanone.
| Compound Name | [3-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 21045566 |
| Molecular Formula | C33H38F3NO3 |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | [3-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-yl]methanone |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)N3CCC(c4cccc(C(F)(F)F)c4)C(O)C3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C33H38F3NO3/c1-20-15-26-27(32(4,5)13-12-31(26,2)3)18-22(20)17-24-9-10-29(40-24)30(39)37-14-11-25(28(38)19-37)21-7-6-8-23(16-21)33(34,35)36/h6-10,15-16,18,25,28,38H,11-14,17,19H2,1-5H3 |
| InChIKey | MFNOJNLISFJSST-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |