C22H27N5O2 — CID 21045743
5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-(2H-tetrazol-5-yl)furan-2-carboxamide (PubChem CID 21045743) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-(2H-tetrazol-5-yl)furan-2-carboxamide.
| Compound Name | 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-(2H-tetrazol-5-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 21045743 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-(2H-tetrazol-5-yl)furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)Nc3nn[nH]n3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C22H27N5O2/c1-13-10-16-17(22(4,5)9-8-21(16,2)3)12-14(13)11-15-6-7-18(29-15)19(28)23-20-24-26-27-25-20/h6-7,10,12H,8-9,11H2,1-5H3,(H2,23,24,25,26,27,28) |
| InChIKey | FWDCEBPVLWKSMK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |