C38H47N5O3 — CID 21045805
N-[[3-[[[4-(oxolan-2-ylmethylamino)pyrimidin-2-yl]amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21045805) has the molecular formula C38H47N5O3 and a molecular weight of 621.83 g/mol. Its IUPAC name is N-[[3-[[[4-(oxolan-2-ylmethylamino)pyrimidin-2-yl]amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[[3-[[[4-(oxolan-2-ylmethylamino)pyrimidin-2-yl]amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21045805 |
| Molecular Formula | C38H47N5O3 |
| Molecular Weight | 621.83 g/mol |
| Exact Mass | 621.37 |
| IUPAC Name | N-[[3-[[[4-(oxolan-2-ylmethylamino)pyrimidin-2-yl]amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)NCc3cccc(CNc4nccc(NCC5CCCO5)n4)c3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C38H47N5O3/c1-25-18-31-32(38(4,5)15-14-37(31,2)3)21-28(25)20-29-11-12-33(46-29)35(44)41-22-26-8-6-9-27(19-26)23-42-36-39-16-13-34(43-36)40-24-30-10-7-17-45-30/h6,8-9,11-13,16,18-19,21,30H,7,10,14-15,17,20,22-24H2,1-5H3,(H,41,44)(H2,39,40,42,43) |
| InChIKey | UDDPYAUUOAMMFB-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.83 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |