C34H37F3N4O2 — CID 21045807
5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-[[3-[[[4-(trifluoromethyl)pyrimidin-2-yl]amino]methyl]phenyl]methyl]furan-2-carboxamide (PubChem CID 21045807) has the molecular formula C34H37F3N4O2 and a molecular weight of 590.69 g/mol. Its IUPAC name is 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-[[3-[[[4-(trifluoromethyl)pyrimidin-2-yl]amino]methyl]phenyl]methyl]furan-2-carboxamide.
| Compound Name | 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-[[3-[[[4-(trifluoromethyl)pyrimidin-2-yl]amino]methyl]phenyl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21045807 |
| Molecular Formula | C34H37F3N4O2 |
| Molecular Weight | 590.69 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-[[3-[[[4-(trifluoromethyl)pyrimidin-2-yl]amino]methyl]phenyl]methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)NCc3cccc(CNc4nccc(C(F)(F)F)n4)c3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C34H37F3N4O2/c1-21-15-26-27(33(4,5)13-12-32(26,2)3)18-24(21)17-25-9-10-28(43-25)30(42)39-19-22-7-6-8-23(16-22)20-40-31-38-14-11-29(41-31)34(35,36)37/h6-11,14-16,18H,12-13,17,19-20H2,1-5H3,(H,39,42)(H,38,40,41) |
| InChIKey | TYZQNLSBMJCSLZ-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.69 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |