C36H42N4O4 — CID 21046569
methyl 6-methyl-2-[[3-[[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]methyl]phenyl]methylamino]pyrimidine-4-carboxylate (PubChem CID 21046569) has the molecular formula C36H42N4O4 and a molecular weight of 594.76 g/mol. Its IUPAC name is methyl 6-methyl-2-[[3-[[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]methyl]phenyl]methylamino]pyrimidine-4-carboxylate.
| Compound Name | methyl 6-methyl-2-[[3-[[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]methyl]phenyl]methylamino]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 21046569 |
| Molecular Formula | C36H42N4O4 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | methyl 6-methyl-2-[[3-[[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]methyl]phenyl]methylamino]pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1cc(C)nc(NCc2cccc(CNC(=O)c3ccc(Cc4cc5c(cc4C)C(C)(C)CCC5(C)C)o3)c2)n1 |
| InChI | InChI=1S/C36H42N4O4/c1-22-15-28-29(36(5,6)14-13-35(28,3)4)19-26(22)18-27-11-12-31(44-27)32(41)37-20-24-9-8-10-25(17-24)21-38-34-39-23(2)16-30(40-34)33(42)43-7/h8-12,15-17,19H,13-14,18,20-21H2,1-7H3,(H,37,41)(H,38,39,40) |
| InChIKey | VRLZQDJSICJBGK-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |